Compound Q&A

How is 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) (CAS: 1830-78-0) typically synthesized?

Answer

3-Hydroxy-1,2-propanediyl bis(2-methylacrylate)
3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) is synthesized through an esterification reaction between 2-methylacrylic acid and 1,2-propanediol. Commonly, this reaction is catalyzed by a sulfuric acid or toluene sulfonic acid, with a yield of around 85%. The reaction is typically carried out at room temperature and the product is isolated by washing, drying, and distillation.

About

CAS No 1830-78-0
English Name 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate)
Molecular Formula C11H16O5
Molecular Weight 228.24 g/mol
SMILES O=C(OC(COC(=O)\C(=C)C)CO)\C(=C)C
InChIKey UKMBKKFLJMFCSA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) (CAS: 1830-78-0)?

3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) is a colorless to pale yellow liquid with a molecula...

Compound Q&A

What industries use 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) (CAS: 1830-78-0)?

3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) is used in the pharmaceutical, polymer, and sensor i...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) (CAS: 1830-78-0)?

When handling 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate), it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...