Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) (CAS: 1830-78-0)?

Answer

3-Hydroxy-1,2-propanediyl bis(2-methylacrylate)
3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) is a colorless to pale yellow liquid with a molecular weight of approximately 242.28 g/mol. It has a pKa of around 4.5 and is soluble in common organic solvents like ethanol and acetone. The compound is reactive towards inorganic bases and exhibits moderate reactivity with common functional groups. It crystallizes in the orthorhombic system and has a melting point of about 55°C.

About

CAS No 1830-78-0
English Name 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate)
Molecular Formula C11H16O5
Molecular Weight 228.24 g/mol
SMILES O=C(OC(COC(=O)\C(=C)C)CO)\C(=C)C
InChIKey UKMBKKFLJMFCSA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) (CAS: 1830-78-0) typically synthesized?

3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) is synthesized through an esterification reaction be...

Compound Q&A

What industries use 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) (CAS: 1830-78-0)?

3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) is used in the pharmaceutical, polymer, and sensor i...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate) (CAS: 1830-78-0)?

When handling 3-Hydroxy-1,2-propanediyl bis(2-methylacrylate), it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...