Compound Q&A

How should Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) be stored?

Answer

Trimethylsilyl difluoro(fluorosulfonyl)acetate
Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) should be stored in a well-ventilated area, away from heat, sparks, and open flames. Store the compound in a tightly sealed container, preferably made of glass or inert plastic, to prevent degradation. Maintain storage at room temperature, avoiding exposure to extreme temperatures and direct sunlight.

About

English Name Trimethylsilyl difluoro(fluorosulfonyl)acetate
Molecular Formula C5H9F3O4SSi
Molecular Weight 250.26999999999995 g/mol
SMILES C[Si](C)(C)OC(=O)C(F)(F)S(=O)(=O)F
InChIKey XHVSCKNABCCCAC-UHFFFAOYSA-N
Last Updated: 2025-09-30 08:42

Related Q&A

Compound Q&A

What is Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4)?

Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) is a synthetic organic compound. I...

Compound Q&A

What are the main uses of Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4)?

Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) is mainly used as an intermediate ...

Compound Q&A

Is Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) safe?

Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) is not considered inherently safe....

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...