Compound Q&A

What is Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4)?

Answer

Trimethylsilyl difluoro(fluorosulfonyl)acetate
Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) is a synthetic organic compound. It is characterized by its complex molecular structure and is primarily used as an intermediate in chemical synthesis. The compound contains carbon, fluorine, sulfur, oxygen, and silicon atoms.

About

English Name Trimethylsilyl difluoro(fluorosulfonyl)acetate
Molecular Formula C5H9F3O4SSi
Molecular Weight 250.26999999999995 g/mol
SMILES C[Si](C)(C)OC(=O)C(F)(F)S(=O)(=O)F
InChIKey XHVSCKNABCCCAC-UHFFFAOYSA-N
Last Updated: 2025-09-30 08:42

Related Q&A

Compound Q&A

What are the main uses of Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4)?

Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) is mainly used as an intermediate ...

Compound Q&A

Is Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) safe?

Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) is not considered inherently safe....

Compound Q&A

How should Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) be stored?

Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) should be stored in a well-ventila...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...