Compound Q&A

What are the main uses of Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4)?

Answer

Trimethylsilyl difluoro(fluorosulfonyl)acetate
Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) is mainly used as an intermediate in the synthesis of pharmaceuticals and other organic compounds. It plays a crucial role in the development of new drugs and materials.

About

English Name Trimethylsilyl difluoro(fluorosulfonyl)acetate
Molecular Formula C5H9F3O4SSi
Molecular Weight 250.27 g/mol
SMILES C[Si](C)(C)OC(=O)C(F)(F)S(=O)(=O)F
InChIKey XHVSCKNABCCCAC-UHFFFAOYSA-N
Last Updated: 2025-09-30 08:42

Related Q&A

Compound Q&A

What is Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4)?

Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) is a synthetic organic compound. I...

Compound Q&A

Is Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) safe?

Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) is not considered inherently safe....

Compound Q&A

How should Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) be stored?

Trimethylsilyl difluoro(fluorosulfonyl)acetate (CAS: 120801-75-4) should be stored in a well-ventila...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...