Compound Q&A

What precautions should be taken when handling Lead bis(2-ethylhexanoate) (CAS: 301-08-6)?

Answer

Lead bis(2-ethylhexanoate)
When handling Lead bis(2-ethylhexanoate) (CAS: 301-08-6), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up carefully, and the material safety data sheet (MSDS) should be consulted for specific guidelines. This compound is toxic and should be handled with care to prevent inhalation or ingestion.

About

CAS No 301-08-6
English Name Lead bis(2-ethylhexanoate)
Molecular Formula C16H30O4Pb
Molecular Weight 351.41 g/mol
SMILES CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Pb+2]
InChIKey ONQAUOMFCUFPBJ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lead bis(2-ethylhexanoate) (CAS: 301-08-6)?

Lead bis(2-ethylhexanoate) (CAS: 301-08-6) is a colorless liquid with a molecular weight of approxim...

Compound Q&A

How is Lead bis(2-ethylhexanoate) (CAS: 301-08-6) typically synthesized?

Lead bis(2-ethylhexanoate) (CAS: 301-08-6) is typically synthesized through the reaction of lead ace...

Compound Q&A

What industries use Lead bis(2-ethylhexanoate) (CAS: 301-08-6)?

Lead bis(2-ethylhexanoate) (CAS: 301-08-6) is used in various industries, including pharmaceuticals,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...