Compound Q&A

What industries use Lead bis(2-ethylhexanoate) (CAS: 301-08-6)?

Answer

Lead bis(2-ethylhexanoate)
Lead bis(2-ethylhexanoate) (CAS: 301-08-6) is used in various industries, including pharmaceuticals, as a stabilizer in fat and oil-based products to enhance their stability. In polymers, it serves as a plasticizer and stabilizer. It is also employed in the manufacturing of sensors and semiconductors for its complexing and stabilizing properties.

About

CAS No 301-08-6
English Name Lead bis(2-ethylhexanoate)
Molecular Formula C16H30O4Pb
Molecular Weight 351.41 g/mol
SMILES CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Pb+2]
InChIKey ONQAUOMFCUFPBJ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lead bis(2-ethylhexanoate) (CAS: 301-08-6)?

Lead bis(2-ethylhexanoate) (CAS: 301-08-6) is a colorless liquid with a molecular weight of approxim...

Compound Q&A

How is Lead bis(2-ethylhexanoate) (CAS: 301-08-6) typically synthesized?

Lead bis(2-ethylhexanoate) (CAS: 301-08-6) is typically synthesized through the reaction of lead ace...

Compound Q&A

What precautions should be taken when handling Lead bis(2-ethylhexanoate) (CAS: 301-08-6)?

When handling Lead bis(2-ethylhexanoate) (CAS: 301-08-6), it is essential to use personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...