Compound Q&A

How is Lead bis(2-ethylhexanoate) (CAS: 301-08-6) typically synthesized?

Answer

Lead bis(2-ethylhexanoate)
Lead bis(2-ethylhexanoate) (CAS: 301-08-6) is typically synthesized through the reaction of lead acetate with 2-ethylhexanoic acid. This process involves the formation of lead diesters, with the resulting compound being purified through distillation. The reaction is often conducted under mild conditions to maintain the stability of the product.

About

CAS No 301-08-6
English Name Lead bis(2-ethylhexanoate)
Molecular Formula C16H30O4Pb
Molecular Weight 351.41 g/mol
SMILES CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Pb+2]
InChIKey ONQAUOMFCUFPBJ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lead bis(2-ethylhexanoate) (CAS: 301-08-6)?

Lead bis(2-ethylhexanoate) (CAS: 301-08-6) is a colorless liquid with a molecular weight of approxim...

Compound Q&A

What industries use Lead bis(2-ethylhexanoate) (CAS: 301-08-6)?

Lead bis(2-ethylhexanoate) (CAS: 301-08-6) is used in various industries, including pharmaceuticals,...

Compound Q&A

What precautions should be taken when handling Lead bis(2-ethylhexanoate) (CAS: 301-08-6)?

When handling Lead bis(2-ethylhexanoate) (CAS: 301-08-6), it is essential to use personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...