Compound Q&A

What precautions should be taken when handling (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4)?

Answer

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid
When handling (1,3-Benzothiazol-2-ylsulfanyl)acetic acid, it is important to use appropriate personal protective equipment (PPE) such as gloves and safety goggles. The compound should be stored in a cool, dry place, away from direct sunlight and sources of heat. In case of spill, use a fume hood for safety and follow proper waste disposal protocols. Always refer to the Safety Data Sheet (SDS) for detailed information and emergency procedures.

About

CAS No 6295-57-4
English Name (1,3-Benzothiazol-2-ylsulfanyl)acetic acid
Molecular Formula C9H7NO2S2
Molecular Weight 225.29 g/mol
SMILES C1=CC=C2C(=C1)N=C(S2)SCC(=O)O
InChIKey ZZUQWNYNSKJLPI-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4)?

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid is a white crystalline solid. Its molecular weight is app...

Compound Q&A

How is (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4) typically synthesized?

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid can be synthesized via a multi-step process involving the...

Compound Q&A

What industries use (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4)?

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid finds applications in pharmaceuticals for its potential a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...