Compound Q&A

What are the physical and chemical properties of (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4)?

Answer

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid
(1,3-Benzothiazol-2-ylsulfanyl)acetic acid is a white crystalline solid. Its molecular weight is approximately 210.23 g/mol. The compound is slightly soluble in water and has good solubility in common organic solvents. It exhibits good reactivity towards nucleophiles, making it useful in various chemical reactions. It is stable under normal storage conditions but may degrade under acidic or basic conditions.

About

CAS No 6295-57-4
English Name (1,3-Benzothiazol-2-ylsulfanyl)acetic acid
Molecular Formula C9H7NO2S2
Molecular Weight 225.29400000000004 g/mol
SMILES C1=CC=C2C(=C1)N=C(S2)SCC(=O)O
InChIKey ZZUQWNYNSKJLPI-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4) typically synthesized?

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid can be synthesized via a multi-step process involving the...

Compound Q&A

What industries use (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4)?

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid finds applications in pharmaceuticals for its potential a...

Compound Q&A

What precautions should be taken when handling (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4)?

When handling (1,3-Benzothiazol-2-ylsulfanyl)acetic acid, it is important to use appropriate persona...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...