Compound Q&A

What industries use (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4)?

Answer

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid
(1,3-Benzothiazol-2-ylsulfanyl)acetic acid finds applications in pharmaceuticals for its potential as an intermediate in drug synthesis. It is also used in the polymer industry for certain functional polymers and in sensors for its unique chemical reactivity. Additionally, it may have applications in the semiconductor industry due to its electronic properties.

About

CAS No 6295-57-4
English Name (1,3-Benzothiazol-2-ylsulfanyl)acetic acid
Molecular Formula C9H7NO2S2
Molecular Weight 225.29 g/mol
SMILES C1=CC=C2C(=C1)N=C(S2)SCC(=O)O
InChIKey ZZUQWNYNSKJLPI-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4)?

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid is a white crystalline solid. Its molecular weight is app...

Compound Q&A

How is (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4) typically synthesized?

(1,3-Benzothiazol-2-ylsulfanyl)acetic acid can be synthesized via a multi-step process involving the...

Compound Q&A

What precautions should be taken when handling (1,3-Benzothiazol-2-ylsulfanyl)acetic acid (CAS: 6295-57-4)?

When handling (1,3-Benzothiazol-2-ylsulfanyl)acetic acid, it is important to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...