Compound Q&A

What industries use 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0)?

Answer

4-Bromo-2-methyl-6-nitroaniline
4-Bromo-2-methyl-6-nitroaniline is used in various industries, including pharmaceuticals, where it serves as an intermediate in the synthesis of drugs. It also finds applications in the polymer industry for the development of dyes and pigments. Additionally, it is used in the electronics sector for the production of sensors and semiconductors due to its electronic properties.

About

CAS No 77811-44-0
English Name 4-Bromo-2-methyl-6-nitroaniline
Molecular Formula C7H7BrN2O2
Molecular Weight 231.05 g/mol
SMILES CC1=CC(=CC(=C1N)[N+](=O)[O-])Br
InChIKey ZXFVKFUXKFPUQJ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0)?

4-Bromo-2-methyl-6-nitroaniline is a white solid with a molecular weight of approximately 244.03 g/m...

Compound Q&A

How is 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0) typically synthesized?

4-Bromo-2-methyl-6-nitroaniline is typically synthesized by the nitration of 4-bromo-2-methylaniline...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0)?

Handling 4-Bromo-2-methyl-6-nitroaniline requires strict safety measures. It should be stored in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...