Compound Q&A

How is 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0) typically synthesized?

Answer

4-Bromo-2-methyl-6-nitroaniline
4-Bromo-2-methyl-6-nitroaniline is typically synthesized by the nitration of 4-bromo-2-methylaniline, followed by bromination. Common methods involve the use of nitric acid and sulfuric acid as reagents, with temperatures ranging from 0 to 20°C. The reaction is carried out under anhydrous conditions to enhance selectivity. Yield and purity are generally high, making this a reliable synthetic route.

About

CAS No 77811-44-0
English Name 4-Bromo-2-methyl-6-nitroaniline
Molecular Formula C7H7BrN2O2
Molecular Weight 231.05 g/mol
SMILES CC1=CC(=CC(=C1N)[N+](=O)[O-])Br
InChIKey ZXFVKFUXKFPUQJ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0)?

4-Bromo-2-methyl-6-nitroaniline is a white solid with a molecular weight of approximately 244.03 g/m...

Compound Q&A

What industries use 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0)?

4-Bromo-2-methyl-6-nitroaniline is used in various industries, including pharmaceuticals, where it s...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0)?

Handling 4-Bromo-2-methyl-6-nitroaniline requires strict safety measures. It should be stored in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...