Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0)?

Answer

4-Bromo-2-methyl-6-nitroaniline
4-Bromo-2-methyl-6-nitroaniline is a white solid with a molecular weight of approximately 244.03 g/mol. It has a pKa of around 8.8 and is slightly soluble in water. This compound is known for its reactivity, particularly towards nucleophilic substitution reactions and reduction. It is often used in organic synthesis and as a precursor in the development of dyes and pharmaceuticals.

About

CAS No 77811-44-0
English Name 4-Bromo-2-methyl-6-nitroaniline
Molecular Formula C7H7BrN2O2
Molecular Weight 231.05 g/mol
SMILES CC1=CC(=CC(=C1N)[N+](=O)[O-])Br
InChIKey ZXFVKFUXKFPUQJ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0) typically synthesized?

4-Bromo-2-methyl-6-nitroaniline is typically synthesized by the nitration of 4-bromo-2-methylaniline...

Compound Q&A

What industries use 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0)?

4-Bromo-2-methyl-6-nitroaniline is used in various industries, including pharmaceuticals, where it s...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2-methyl-6-nitroaniline (CAS: 77811-44-0)?

Handling 4-Bromo-2-methyl-6-nitroaniline requires strict safety measures. It should be stored in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...