Compound Q&A

How is 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2) typically synthesized?

Answer

7-Chloro-6-nitro-4(1H)-quinazolinone
7-Chloro-6-nitro-4(1H)-quinazolinone is typically synthesized via the nitration of 7-chloro-4(1H)-quinazolinone followed by subsequent purification. Commonly, this process involves the use of nitric acid in the presence of sulfuric acid as a catalyst. The yield is usually around 70-80%, with good selectivity for the nitro group introduction.

About

CAS No 53449-14-2
English Name 7-Chloro-6-nitro-4(1H)-quinazolinone
Molecular Formula C8H4ClN3O3
Molecular Weight 225.59 g/mol
SMILES [O-][N+](=O)c1cc2c(=O)[nH]cnc2cc1Cl
InChIKey URDYTQYZXZKBQT-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2)?

7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2) is a crystalline compound with a molecular we...

Compound Q&A

What industries use 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2)?

7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2) finds applications in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2)?

When handling 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2), it is essential to use persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...