Compound Q&A

What are the physical and chemical properties of 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2)?

Answer

7-Chloro-6-nitro-4(1H)-quinazolinone
7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2) is a crystalline compound with a molecular weight of approximately 276.04 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles, making it suitable for various synthetic transformations. It can undergo nitration, chlorination, and other electrophilic reactions.

About

CAS No 53449-14-2
English Name 7-Chloro-6-nitro-4(1H)-quinazolinone
Molecular Formula C8H4ClN3O3
Molecular Weight 225.59 g/mol
SMILES [O-][N+](=O)c1cc2c(=O)[nH]cnc2cc1Cl
InChIKey URDYTQYZXZKBQT-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2) typically synthesized?

7-Chloro-6-nitro-4(1H)-quinazolinone is typically synthesized via the nitration of 7-chloro-4(1H)-qu...

Compound Q&A

What industries use 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2)?

7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2) finds applications in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2)?

When handling 7-Chloro-6-nitro-4(1H)-quinazolinone (CAS: 53449-14-2), it is essential to use persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...