Compound Q&A

What industries use 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6)?

Answer

6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide
6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in the production of certain polymers, sensors, and semiconductors due to its chemical reactivity and stability properties.

About

CAS No 58-94-6
English Name 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide
Molecular Formula C7H6ClN3O4S2
Molecular Weight 295.73 g/mol
SMILES c1c2c(cc(c1Cl)S(=O)(=O)N)S(=O)(=O)N=CN2
InChIKey JBMKAUGHUNFTOL-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6)?

The compound, 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6), is a crys...

Compound Q&A

How is 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6) typically synthesized?

6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6) is typically synthesized...

Compound Q&A

What precautions should be taken when handling 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6)?

When handling 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6), it is ess...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...