Compound Q&A

How is 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6) typically synthesized?

Answer

6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide
6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6) is typically synthesized via a multi-step process involving the coupling of 4-chlorobenzothiazole with dimethyl sulfoxide nitrosourea. This process often involves the use of sodium hydride as a catalyst. The yield is generally around 70-80%, with selectivity to the desired product being high.

About

CAS No 58-94-6
English Name 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide
Molecular Formula C7H6ClN3O4S2
Molecular Weight 295.73 g/mol
SMILES c1c2c(cc(c1Cl)S(=O)(=O)N)S(=O)(=O)N=CN2
InChIKey JBMKAUGHUNFTOL-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6)?

The compound, 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6), is a crys...

Compound Q&A

What industries use 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6)?

6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6) is primarily used in the...

Compound Q&A

What precautions should be taken when handling 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6)?

When handling 6-Chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide (CAS: 58-94-6), it is ess...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...