Compound Q&A

What industries use 2-Methyl-2-propanyl (4-aminophenyl)carbamate (CAS: 71026-66-9)?

Answer

2-Methyl-2-propanyl (4-aminophenyl)carbamate
2-Methyl-2-propanyl (4-aminophenyl)carbamate is used in the pharmaceutical industry for the synthesis of certain drugs. It is also applicable in the polymer industry for the modification of polymer properties. Additionally, it can be used in the development of sensors and as a precursor in semiconductor manufacturing processes.

About

CAS No 71026-66-9
English Name 2-Methyl-2-propanyl (4-aminophenyl)carbamate
Molecular Formula C11H16N2O2
Molecular Weight 208.26 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=C(C=C1)N
InChIKey WIVYTYZCVWHWSH-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-aminophenyl)carbamate (CAS: 71026-66-9)?

2-Methyl-2-propanyl (4-aminophenyl)carbamate is a solid compound with a crystalline form. Its molecu...

Compound Q&A

How is 2-Methyl-2-propanyl (4-aminophenyl)carbamate (CAS: 71026-66-9) typically synthesized?

2-Methyl-2-propanyl (4-aminophenyl)carbamate is synthesized through an amide coupling reaction. Typi...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4-aminophenyl)carbamate (CAS: 71026-66-9)?

When handling 2-Methyl-2-propanyl (4-aminophenyl)carbamate, it is recommended to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...