Compound Q&A

What industries use 2-amino-4-phenylbutanoic acid (CAS: 1012-05-1)?

Answer

2-amino-4-phenylbutanoic acid
2-Amino-4-phenylbutanoic acid is used in the pharmaceutical industry for the synthesis of certain drugs due to its biological activity. It is also used in the preparation of organic polymers, particularly in the development of biodegradable materials. Additionally, it can be employed in the manufacturing of sensors and semiconductors.

About

CAS No 1012-05-1
English Name 2-amino-4-phenylbutanoic acid
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES C1=CC=C(C=C1)CCC(C(=O)O)N
InChIKey JTTHKOPSMAVJFE-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-amino-4-phenylbutanoic acid (CAS: 1012-05-1)?

2-Amino-4-phenylbutanoic acid is a white to off-white crystalline solid with a molecular weight of a...

Compound Q&A

How is 2-amino-4-phenylbutanoic acid (CAS: 1012-05-1) typically synthesized?

2-Amino-4-phenylbutanoic acid is typically synthesized by the coupling of phenylalanine with an amin...

Compound Q&A

What precautions should be taken when handling 2-amino-4-phenylbutanoic acid (CAS: 1012-05-1)?

When handling 2-amino-4-phenylbutanoic acid, it is important to use personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...