Compound Q&A

How is 2-amino-4-phenylbutanoic acid (CAS: 1012-05-1) typically synthesized?

Answer

2-amino-4-phenylbutanoic acid
2-Amino-4-phenylbutanoic acid is typically synthesized by the coupling of phenylalanine with an amino acid or via the condensation of 4-phenylbutyric anhydride with an amine. Commonly, the synthesis involves the use of coupling agents like dicyclohexylcarbodiimide (DCC) and 4-(dimethylamino)pyridine (DMAP) as catalysts, with good yield and selectivity.

About

CAS No 1012-05-1
English Name 2-amino-4-phenylbutanoic acid
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES C1=CC=C(C=C1)CCC(C(=O)O)N
InChIKey JTTHKOPSMAVJFE-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-amino-4-phenylbutanoic acid (CAS: 1012-05-1)?

2-Amino-4-phenylbutanoic acid is a white to off-white crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 2-amino-4-phenylbutanoic acid (CAS: 1012-05-1)?

2-Amino-4-phenylbutanoic acid is used in the pharmaceutical industry for the synthesis of certain dr...

Compound Q&A

What precautions should be taken when handling 2-amino-4-phenylbutanoic acid (CAS: 1012-05-1)?

When handling 2-amino-4-phenylbutanoic acid, it is important to use personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...