Compound Q&A

What industries use [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7)?

Answer

[2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (1:1)
This compound is used in the pharmaceutical industry for the synthesis of drug molecules, particularly those involving boronate esters. It is also utilized in polymer chemistry for the modification of boronic acid functionalities, and in the semiconductor industry for the production of advanced materials with specific optical and electronic properties.

About

English Name [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (1:1)
Molecular Formula C8H11BClNO4
Molecular Weight 231.44 g/mol
SMILES B(C1=C(C=C(C=C1)C(=O)OC)N)(O)O.Cl
InChIKey IDUSDMZTKZZVAW-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7)?

This compound is a crystalline solid with a molecular weight of approximately 313.5 g/mol. It has a ...

Compound Q&A

How is [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7) typically synthesized?

It is synthesized via a multi-step process involving the protection of an amine group, subsequent es...

Compound Q&A

What precautions should be taken when handling [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7)?

When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...