Compound Q&A

How is [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7) typically synthesized?

Answer

[2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (1:1)
It is synthesized via a multi-step process involving the protection of an amine group, subsequent esterification, and finally the formation of the boronic acid derivative. Commonly used catalysts include palladium(II) acetate and triphenylphosphine. The yield is typically around 85-90%. This method ensures high selectivity and good purity.

About

English Name [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (1:1)
Molecular Formula C8H11BClNO4
Molecular Weight 231.44 g/mol
SMILES B(C1=C(C=C(C=C1)C(=O)OC)N)(O)O.Cl
InChIKey IDUSDMZTKZZVAW-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7)?

This compound is a crystalline solid with a molecular weight of approximately 313.5 g/mol. It has a ...

Compound Q&A

What industries use [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7)?

This compound is used in the pharmaceutical industry for the synthesis of drug molecules, particular...

Compound Q&A

What precautions should be taken when handling [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7)?

When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...