Compound Q&A

What are the physical and chemical properties of [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7)?

Answer

[2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (1:1)
This compound is a crystalline solid with a molecular weight of approximately 313.5 g/mol. It has a solubility of about 1.5 g/L in water. Chemically, it is reactive towards nucleophiles and forms stable complexes with metal ions. It is hydrolytically stable but should be stored below 30°C to prevent degradation.

About

English Name [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (1:1)
Molecular Formula C8H11BClNO4
Molecular Weight 231.44 g/mol
SMILES B(C1=C(C=C(C=C1)C(=O)OC)N)(O)O.Cl
InChIKey IDUSDMZTKZZVAW-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7) typically synthesized?

It is synthesized via a multi-step process involving the protection of an amine group, subsequent es...

Compound Q&A

What industries use [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7)?

This compound is used in the pharmaceutical industry for the synthesis of drug molecules, particular...

Compound Q&A

What precautions should be taken when handling [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid hydrochloride (CAS: 380430-55-7)?

When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...