Compound Q&A

What industries use {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate (CAS: 174649-09-3)?

Answer

{(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate
This compound is used in the pharmaceutical industry for the development of new drugs due to its structural similarity to known bioactive molecules. It may also find applications in the synthesis of polymers and sensors due to its chemical properties. Further, it could be of interest in the semiconductor industry for its ability to act as a precursor in certain chemical processes.

About

English Name {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate
Molecular Formula C15H19FN2O6S
Molecular Weight 374.39 g/mol
SMILES CS(=O)(=O)OC[C@H]1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F
InChIKey UCVIKCGVGWBTTI-GFCCVEGCSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate (CAS: 174649-09-3)?

This compound is an organic solid with a crystalline form. It has a molecular weight of approximatel...

Compound Q&A

How is {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate (CAS: 174649-09-3) typically synthesized?

This compound is typically synthesized via a multi-step process involving the coupling of a fluoroan...

Compound Q&A

What precautions should be taken when handling {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate (CAS: 174649-09-3)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...