Compound Q&A

What are the physical and chemical properties of {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate (CAS: 174649-09-3)?

Answer

{(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate
This compound is an organic solid with a crystalline form. It has a molecular weight of approximately 468.45 g/mol and a solubility in water of about 0.5 g/L at 25°C. It is moderately reactive, especially in acidic conditions. It is not flammable. The compound is stable under normal conditions but should be stored in a cool, dry place away from heat and direct sunlight.

About

English Name {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate
Molecular Formula C15H19FN2O6S
Molecular Weight 374.39 g/mol
SMILES CS(=O)(=O)OC[C@H]1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F
InChIKey UCVIKCGVGWBTTI-GFCCVEGCSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate (CAS: 174649-09-3) typically synthesized?

This compound is typically synthesized via a multi-step process involving the coupling of a fluoroan...

Compound Q&A

What industries use {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate (CAS: 174649-09-3)?

This compound is used in the pharmaceutical industry for the development of new drugs due to its str...

Compound Q&A

What precautions should be taken when handling {(5R)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl methanesulfonate (CAS: 174649-09-3)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...