Compound Q&A

What industries use 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4)?

Answer

3-(3,4-Dimethoxyphenyl)acrylic acid
3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4) finds applications in various industries. It is used in the pharmaceutical sector for the synthesis of certain drugs, in polymer chemistry for producing functional polymers, and in sensors for detecting specific chemical species. Additionally, it is utilized in the semiconductor industry for its unique properties.

About

CAS No 14737-89-4
English Name 3-(3,4-Dimethoxyphenyl)acrylic acid
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES COC1=C(C=C(C=C1)C=CC(=O)O)OC
InChIKey HJBWJAPEBGSQPR-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4)?

3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4) is a crystalline solid with a molecular weight...

Compound Q&A

How is 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4) typically synthesized?

3-(3,4-Dimethoxyphenyl)acrylic acid is commonly synthesized via the Friedel-Crafts acylation of 3,4-...

Compound Q&A

What precautions should be taken when handling 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4)?

When handling 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...