Compound Q&A

What are the physical and chemical properties of 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4)?

Answer

3-(3,4-Dimethoxyphenyl)acrylic acid
3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4) is a crystalline solid with a molecular weight of approximately 214.15 g/mol. It has a melting point of around 128-132°C and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can undergo polymerization under certain conditions. It reacts readily with bases and nucleophiles.

About

CAS No 14737-89-4
English Name 3-(3,4-Dimethoxyphenyl)acrylic acid
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES COC1=C(C=C(C=C1)C=CC(=O)O)OC
InChIKey HJBWJAPEBGSQPR-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4) typically synthesized?

3-(3,4-Dimethoxyphenyl)acrylic acid is commonly synthesized via the Friedel-Crafts acylation of 3,4-...

Compound Q&A

What industries use 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4)?

3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4) finds applications in various industries. It i...

Compound Q&A

What precautions should be taken when handling 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4)?

When handling 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...