Compound Q&A

How is 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4) typically synthesized?

Answer

3-(3,4-Dimethoxyphenyl)acrylic acid
3-(3,4-Dimethoxyphenyl)acrylic acid is commonly synthesized via the Friedel-Crafts acylation of 3,4-dimethoxybenzaldehyde with acetyl chloride in the presence of a strong acid catalyst like concentrated sulfuric acid. The reaction typically proceeds with high yield and good selectivity, making it a straightforward method for producing this compound.

About

CAS No 14737-89-4
English Name 3-(3,4-Dimethoxyphenyl)acrylic acid
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES COC1=C(C=C(C=C1)C=CC(=O)O)OC
InChIKey HJBWJAPEBGSQPR-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4)?

3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4) is a crystalline solid with a molecular weight...

Compound Q&A

What industries use 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4)?

3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4) finds applications in various industries. It i...

Compound Q&A

What precautions should be taken when handling 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4)?

When handling 3-(3,4-Dimethoxyphenyl)acrylic acid (CAS: 14737-89-4), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...