Compound Q&A

What industries use AZD-7762 (CAS: 860352-01-8)?

Answer

AZD-7762
AZD-7762 (CAS: 860352-01-8) is primarily used in the pharmaceutical industry. It serves as a key intermediate in the development of new drugs, particularly in the field of oncology. Additionally, it has potential applications in the polymer industry for developing advanced materials and in the semiconductor industry for electronic applications.

About

English Name AZD-7762
Molecular Formula C17H19FN4O2S
Molecular Weight 362.42 g/mol
SMILES NC(=O)Nc1cc(sc1C(=O)N[C@H]1CCCNC1)c1cccc(c1)F
InChIKey IAYGCINLNONXHY-LBPRGKRZSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of AZD-7762 (CAS: 860352-01-8)?

AZD-7762 (CAS: 860352-01-8) is a crystalline compound with a molecular weight of approximately 536.8...

Compound Q&A

How is AZD-7762 (CAS: 860352-01-8) typically synthesized?

AZD-7762 (CAS: 860352-01-8) is synthesized through a multi-step reaction involving the condensation ...

Compound Q&A

What precautions should be taken when handling AZD-7762 (CAS: 860352-01-8)?

When handling AZD-7762 (CAS: 860352-01-8), it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...