Compound Q&A

How is AZD-7762 (CAS: 860352-01-8) typically synthesized?

Answer

AZD-7762
AZD-7762 (CAS: 860352-01-8) is synthesized through a multi-step reaction involving the condensation of a primary amine with a carboxylic acid derivative, followed by selective functional group modifications. Commonly used catalysts include palladium-based systems in the presence of base. The yield is typically around 70% with high selectivity and good purity.

About

English Name AZD-7762
Molecular Formula C17H19FN4O2S
Molecular Weight 362.42 g/mol
SMILES NC(=O)Nc1cc(sc1C(=O)N[C@H]1CCCNC1)c1cccc(c1)F
InChIKey IAYGCINLNONXHY-LBPRGKRZSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of AZD-7762 (CAS: 860352-01-8)?

AZD-7762 (CAS: 860352-01-8) is a crystalline compound with a molecular weight of approximately 536.8...

Compound Q&A

What industries use AZD-7762 (CAS: 860352-01-8)?

AZD-7762 (CAS: 860352-01-8) is primarily used in the pharmaceutical industry. It serves as a key int...

Compound Q&A

What precautions should be taken when handling AZD-7762 (CAS: 860352-01-8)?

When handling AZD-7762 (CAS: 860352-01-8), it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...