Compound Q&A

What industries use Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0)?

Answer

Sodium 3-(propargyloxy)propyl sulfonate
Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0) is used in various industries. It is employed as a surfactant in the production of pharmaceuticals, where it helps in improving drug solubility and bioavailability. In the polymer industry, it serves as a compatibilizer to enhance the adhesion between different polymers. Additionally, it finds applications in the semiconductor industry as a cleaning agent and in sensor technology as a functional group for surface modification.

About

CAS No 30290-53-0
English Name Sodium 3-(propargyloxy)propyl sulfonate
Molecular Formula C6H9NaO4S
Molecular Weight 200.19 g/mol
SMILES C#CCOCCCS(=O)(=O)[O-].[Na+]
InChIKey ZUCPIMRYPXHJIP-UHFFFAOYSA-M
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0)?

Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0) is a crystalline solid with a molecular we...

Compound Q&A

How is Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0) typically synthesized?

Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0) is typically synthesized via the reaction ...

Compound Q&A

What precautions should be taken when handling Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0)?

When handling Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0), it is essential to wear app...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...