Compound Q&A

How is Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0) typically synthesized?

Answer

Sodium 3-(propargyloxy)propyl sulfonate
Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0) is typically synthesized via the reaction of propargyl alcohol with sulfur trioxide in the presence of triethylamine. The process involves the formation of propargyloxysulfonic acid, followed by the sodium salt formation. Commonly, triethylamine is used as a base catalyst, and the reaction is carried out in a dichloromethane solvent. The yield is around 75-80%.

About

CAS No 30290-53-0
English Name Sodium 3-(propargyloxy)propyl sulfonate
Molecular Formula C6H9NaO4S
Molecular Weight 200.19 g/mol
SMILES C#CCOCCCS(=O)(=O)[O-].[Na+]
InChIKey ZUCPIMRYPXHJIP-UHFFFAOYSA-M
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0)?

Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0) is a crystalline solid with a molecular we...

Compound Q&A

What industries use Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0)?

Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0) is used in various industries. It is emplo...

Compound Q&A

What precautions should be taken when handling Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0)?

When handling Sodium 3-(propargyloxy)propyl sulfonate (CAS: 30290-53-0), it is essential to wear app...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...