Compound Q&A

What industries use 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 113100-53-1)?

Answer

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is used primarily in the pharmaceutical industry, where it serves as an intermediate for the synthesis of various drugs. It is also utilized in the polymer industry for the development of novel materials with unique properties. Additionally, this compound has applications in the production of sensors and semiconductors due to its electronic and chemical properties.

About

English Name 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Molecular Formula C6H5F3N2O2
Molecular Weight 194.11 g/mol
SMILES CN1C=C(C(=N1)C(F)(F)F)C(=O)O
InChIKey FZNKJQNEJGXCJH-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 113100-53-1)?

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid has a crystalline form at room temperatur...

Compound Q&A

How is 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 113100-53-1) typically synthesized?

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid can be synthesized via a multistep proces...

Compound Q&A

What precautions should be taken when handling 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 113100-53-1)?

When handling 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, it is important to use pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...