Compound Q&A

What are the physical and chemical properties of 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 113100-53-1)?

Answer

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid has a crystalline form at room temperature. The molecular weight is approximately 232.07 g/mol. It is slightly soluble in water and has a pKa of about 3.7. The compound is relatively stable but can undergo hydrolysis under basic conditions. It is an organic acid with strong electron-withdrawing groups, making it a potent electrophile in organic synthesis.

About

English Name 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Molecular Formula C6H5F3N2O2
Molecular Weight 194.11 g/mol
SMILES CN1C=C(C(=N1)C(F)(F)F)C(=O)O
InChIKey FZNKJQNEJGXCJH-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 113100-53-1) typically synthesized?

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid can be synthesized via a multistep proces...

Compound Q&A

What industries use 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 113100-53-1)?

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is used primarily in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 113100-53-1)?

When handling 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, it is important to use pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...