Compound Q&A

What industries use (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide (CAS: 257933-82-7)?

Answer

(2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide
This compound is primarily used in the pharmaceutical industry for the development of novel drug candidates due to its specific binding affinity to certain targets. It also finds applications in the polymer industry for the synthesis of advanced materials and in the electronic industry for use in semiconductor and sensor technologies.

About

English Name (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide
Molecular Formula C24H23ClFN5O2
Molecular Weight 456.95 g/mol
SMILES CCOC1=C(C=C2C(=C1)N=CC(=C2NC3=CC(=C(C=C3)F)Cl)C#N)NC(=O)C=CCN(C)C
InChIKey WVUNYSQLFKLYNI-AATRIKPKSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide (CAS: 257933-82-7)?

This compound is in a crystalline form. It has a molecular weight of approximately 624 g/mol and is ...

Compound Q&A

How is (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide (CAS: 257933-82-7) typically synthesized?

This compound is typically synthesized via a multi-step route involving the condensation of a 3-cyan...

Compound Q&A

What precautions should be taken when handling (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide (CAS: 257933-82-7)?

When handling this compound, wear appropriate personal protective equipment (PPE) including gloves, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...