Compound Q&A

What are the physical and chemical properties of (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide (CAS: 257933-82-7)?

Answer

(2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide
This compound is in a crystalline form. It has a molecular weight of approximately 624 g/mol and is slightly soluble in common organic solvents such as methanol and acetonitrile. It shows moderate reactivity with nucleophiles and is stable under neutral conditions but can be sensitive to strong oxidizing agents. It is typically used in synthesis without significant issues due to its chemical stability.

About

English Name (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide
Molecular Formula C24H23ClFN5O2
Molecular Weight 456.95 g/mol
SMILES CCOC1=C(C=C2C(=C1)N=CC(=C2NC3=CC(=C(C=C3)F)Cl)C#N)NC(=O)C=CCN(C)C
InChIKey WVUNYSQLFKLYNI-AATRIKPKSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide (CAS: 257933-82-7) typically synthesized?

This compound is typically synthesized via a multi-step route involving the condensation of a 3-cyan...

Compound Q&A

What industries use (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide (CAS: 257933-82-7)?

This compound is primarily used in the pharmaceutical industry for the development of novel drug can...

Compound Q&A

What precautions should be taken when handling (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl}-4-(dimethylamino)-2-butenamide (CAS: 257933-82-7)?

When handling this compound, wear appropriate personal protective equipment (PPE) including gloves, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...