Compound Q&A

What precautions should be taken when handling 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6)?

Answer

2-Nitro-4-(trifluoromethyl)aniline
When handling 2-Nitro-4-(trifluoromethyl)aniline, it is essential to use personal protective equipment such as gloves, safety goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be managed using appropriate spill kits, and the material safety data sheet (MSDS) should be consulted for detailed safety information.

About

CAS No 400-98-6
English Name 2-Nitro-4-(trifluoromethyl)aniline
Molecular Formula C7H5F3N2O2
Molecular Weight 206.12 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])N
InChIKey ATXBGHLILIABGX-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6)?

2-Nitro-4-(trifluoromethyl)aniline has a crystalline form and a molecular weight of approximately 22...

Compound Q&A

How is 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6) typically synthesized?

2-Nitro-4-(trifluoromethyl)aniline is typically synthesized through the nitration of 4-(trifluoromet...

Compound Q&A

What industries use 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6)?

2-Nitro-4-(trifluoromethyl)aniline is used in the pharmaceutical industry for the synthesis of certa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...