Compound Q&A

How is 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6) typically synthesized?

Answer

2-Nitro-4-(trifluoromethyl)aniline
2-Nitro-4-(trifluoromethyl)aniline is typically synthesized through the nitration of 4-(trifluoromethyl)aniline. This process involves the use of a strong nitration mixture, such as a mixture of nitric acid and sulfuric acid, under controlled conditions to ensure high selectivity and yield.

About

CAS No 400-98-6
English Name 2-Nitro-4-(trifluoromethyl)aniline
Molecular Formula C7H5F3N2O2
Molecular Weight 206.12 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])N
InChIKey ATXBGHLILIABGX-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6)?

2-Nitro-4-(trifluoromethyl)aniline has a crystalline form and a molecular weight of approximately 22...

Compound Q&A

What industries use 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6)?

2-Nitro-4-(trifluoromethyl)aniline is used in the pharmaceutical industry for the synthesis of certa...

Compound Q&A

What precautions should be taken when handling 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6)?

When handling 2-Nitro-4-(trifluoromethyl)aniline, it is essential to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...