Compound Q&A

What industries use 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6)?

Answer

2-Nitro-4-(trifluoromethyl)aniline
2-Nitro-4-(trifluoromethyl)aniline is used in the pharmaceutical industry for the synthesis of certain drugs, and in the chemical industry for the production of dyes and other organic compounds. It is also utilized in the sensing and semiconductor industries for specific applications.

About

CAS No 400-98-6
English Name 2-Nitro-4-(trifluoromethyl)aniline
Molecular Formula C7H5F3N2O2
Molecular Weight 206.12 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])N
InChIKey ATXBGHLILIABGX-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6)?

2-Nitro-4-(trifluoromethyl)aniline has a crystalline form and a molecular weight of approximately 22...

Compound Q&A

How is 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6) typically synthesized?

2-Nitro-4-(trifluoromethyl)aniline is typically synthesized through the nitration of 4-(trifluoromet...

Compound Q&A

What precautions should be taken when handling 2-Nitro-4-(trifluoromethyl)aniline (CAS: 400-98-6)?

When handling 2-Nitro-4-(trifluoromethyl)aniline, it is essential to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...