Compound Q&A

What industries use (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6)?

Answer

(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene
(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene is primarily used in the pharmaceutical industry for the synthesis of complex natural products. It also finds applications in polymer chemistry for the preparation of novel materials. In addition, it is utilized in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 1135-66-6
English Name (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene
Molecular Formula C15H24
Molecular Weight 204.36 g/mol
SMILES CC1(CCC=C2[C@@]13CC[C@@H](C3)C2(C)C)C
InChIKey CQUAYTJDLQBXCQ-NHYWBVRUSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6)?

(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene is a colorless, odorless liquid at room...

Compound Q&A

How is (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6) typically synthesized?

(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene is synthesized through ring expansion o...

Compound Q&A

What precautions should be taken when handling (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6)?

When handling (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene, it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...