Compound Q&A

How is (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6) typically synthesized?

Answer

(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene
(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene is synthesized through ring expansion of a cyclohexene oxide using a borane reagent. The process involves selective ring opening and subsequent cyclization. This method ensures high selectivity and yield, making it a preferred synthesis route in organic chemistry.

About

CAS No 1135-66-6
English Name (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene
Molecular Formula C15H24
Molecular Weight 204.36 g/mol
SMILES CC1(CCC=C2[C@@]13CC[C@@H](C3)C2(C)C)C
InChIKey CQUAYTJDLQBXCQ-NHYWBVRUSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6)?

(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene is a colorless, odorless liquid at room...

Compound Q&A

What industries use (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6)?

(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6)?

When handling (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene, it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...