Compound Q&A

What are the physical and chemical properties of (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6)?

Answer

(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene
(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene is a colorless, odorless liquid at room temperature. The molecular weight is approximately 246.4 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and chloroform. Chemically, it is relatively stable but can react with strong oxidizing agents. It is used in the synthesis of other organic compounds and as a precursor in various chemical reactions.

About

CAS No 1135-66-6
English Name (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene
Molecular Formula C15H24
Molecular Weight 204.36 g/mol
SMILES CC1(CCC=C2[C@@]13CC[C@@H](C3)C2(C)C)C
InChIKey CQUAYTJDLQBXCQ-NHYWBVRUSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6) typically synthesized?

(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene is synthesized through ring expansion o...

Compound Q&A

What industries use (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6)?

(1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene (CAS: 1135-66-6)?

When handling (1R,8S)-2,2,7,7-Tetramethyltricyclo[6.2.1.0~1,6~]undec-5-ene, it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...