Compound Q&A

What industries use 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2)?

Answer

2-Amino-1,4-benzenedisulfonic acid
2-Amino-1,4-benzenedisulfonic acid is widely used in the pharmaceutical industry for the synthesis of various drugs, in the polymer industry for the production of special fibers, and in the semiconductor industry for the fabrication of electronic components. It also finds applications in the development of sensors and as a ligand in analytical chemistry.

About

CAS No 98-44-2
English Name 2-Amino-1,4-benzenedisulfonic acid
Molecular Formula C6H7NO6S2
Molecular Weight 253.26 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)N)S(=O)(=O)O
InChIKey LDCCBULMAFILCT-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2)?

2-Amino-1,4-benzenedisulfonic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2) typically synthesized?

2-Amino-1,4-benzenedisulfonic acid is typically synthesized by the reaction of benzene with sulfur t...

Compound Q&A

What precautions should be taken when handling 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2)?

When handling 2-Amino-1,4-benzenedisulfonic acid, it is important to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...