Compound Q&A

How is 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2) typically synthesized?

Answer

2-Amino-1,4-benzenedisulfonic acid
2-Amino-1,4-benzenedisulfonic acid is typically synthesized by the reaction of benzene with sulfur trioxide followed by reaction with ammonia. Commonly, a mixture of benzene, sulfur trioxide, and ammonia is heated under pressure to produce the desired compound. This method provides a good yield and selectivity, although careful handling of the reactants is necessary.

About

CAS No 98-44-2
English Name 2-Amino-1,4-benzenedisulfonic acid
Molecular Formula C6H7NO6S2
Molecular Weight 253.26 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)N)S(=O)(=O)O
InChIKey LDCCBULMAFILCT-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2)?

2-Amino-1,4-benzenedisulfonic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

What industries use 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2)?

2-Amino-1,4-benzenedisulfonic acid is widely used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2)?

When handling 2-Amino-1,4-benzenedisulfonic acid, it is important to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...