Compound Q&A

What are the physical and chemical properties of 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2)?

Answer

2-Amino-1,4-benzenedisulfonic acid
2-Amino-1,4-benzenedisulfonic acid is a crystalline solid with a molecular weight of approximately 216.18 g/mol. It is slightly soluble in water and is known for its reactivity towards metal ions and its ability to form complexes. This compound exhibits moderate basicity due to the amino group and has a high affinity for sulfuric acid groups.

About

CAS No 98-44-2
English Name 2-Amino-1,4-benzenedisulfonic acid
Molecular Formula C6H7NO6S2
Molecular Weight 253.26 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)N)S(=O)(=O)O
InChIKey LDCCBULMAFILCT-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2) typically synthesized?

2-Amino-1,4-benzenedisulfonic acid is typically synthesized by the reaction of benzene with sulfur t...

Compound Q&A

What industries use 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2)?

2-Amino-1,4-benzenedisulfonic acid is widely used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 2-Amino-1,4-benzenedisulfonic acid (CAS: 98-44-2)?

When handling 2-Amino-1,4-benzenedisulfonic acid, it is important to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...