Compound Q&A

What industries use Difluoro(phenyl)acetic acid (CAS: 360-03-2)?

Answer

Difluoro(phenyl)acetic acid
Difluoro(phenyl)acetic acid (CAS: 360-03-2) is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals and agrochemicals due to its reactivity. Additionally, it is utilized in the polymer industry for the development of special polymers and in the semiconductor industry for the production of photoresists and other electronic materials. Its use in sensors and as a ligand in coordination chemistry is also reported.

About

CAS No 360-03-2
English Name Difluoro(phenyl)acetic acid
Molecular Formula C8H6F2O2
Molecular Weight 172.13 g/mol
SMILES C1=CC=C(C=C1)C(C(=O)O)(F)F
InChIKey PFKSLFZFBCIJOI-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Difluoro(phenyl)acetic acid (CAS: 360-03-2)?

Difluoro(phenyl)acetic acid (CAS: 360-03-2) is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is Difluoro(phenyl)acetic acid (CAS: 360-03-2) typically synthesized?

Difluoro(phenyl)acetic acid (CAS: 360-03-2) is typically synthesized via the Friedel-Crafts acylatio...

Compound Q&A

What precautions should be taken when handling Difluoro(phenyl)acetic acid (CAS: 360-03-2)?

When handling Difluoro(phenyl)acetic acid (CAS: 360-03-2), it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...