Compound Q&A

How is Difluoro(phenyl)acetic acid (CAS: 360-03-2) typically synthesized?

Answer

Difluoro(phenyl)acetic acid
Difluoro(phenyl)acetic acid (CAS: 360-03-2) is typically synthesized via the Friedel-Crafts acylation of a phenyl derivative with acetyl chloride in the presence of aluminum chloride as a catalyst. The reaction involves the introduction of the acetyl group onto the phenyl ring followed by the subsequent conversion to the carboxylic acid function. This process provides good yield and high selectivity.

About

CAS No 360-03-2
English Name Difluoro(phenyl)acetic acid
Molecular Formula C8H6F2O2
Molecular Weight 172.13 g/mol
SMILES C1=CC=C(C=C1)C(C(=O)O)(F)F
InChIKey PFKSLFZFBCIJOI-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Difluoro(phenyl)acetic acid (CAS: 360-03-2)?

Difluoro(phenyl)acetic acid (CAS: 360-03-2) is a white crystalline solid with a molecular weight of ...

Compound Q&A

What industries use Difluoro(phenyl)acetic acid (CAS: 360-03-2)?

Difluoro(phenyl)acetic acid (CAS: 360-03-2) is used in various industries. It is a key intermediate ...

Compound Q&A

What precautions should be taken when handling Difluoro(phenyl)acetic acid (CAS: 360-03-2)?

When handling Difluoro(phenyl)acetic acid (CAS: 360-03-2), it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...