Compound Q&A

What are the physical and chemical properties of Difluoro(phenyl)acetic acid (CAS: 360-03-2)?

Answer

Difluoro(phenyl)acetic acid
Difluoro(phenyl)acetic acid (CAS: 360-03-2) is a white crystalline solid with a molecular weight of approximately 184.05 g/mol. It has a low solubility in water (2.56 g/L at 20°C) but is more soluble in organic solvents like ethanol and dichloromethane. The compound is relatively stable under normal conditions but can react with strong bases to form the corresponding salts. It is a carboxylic acid and can undergo typical acid-base reactions.

About

CAS No 360-03-2
English Name Difluoro(phenyl)acetic acid
Molecular Formula C8H6F2O2
Molecular Weight 172.13 g/mol
SMILES C1=CC=C(C=C1)C(C(=O)O)(F)F
InChIKey PFKSLFZFBCIJOI-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Difluoro(phenyl)acetic acid (CAS: 360-03-2) typically synthesized?

Difluoro(phenyl)acetic acid (CAS: 360-03-2) is typically synthesized via the Friedel-Crafts acylatio...

Compound Q&A

What industries use Difluoro(phenyl)acetic acid (CAS: 360-03-2)?

Difluoro(phenyl)acetic acid (CAS: 360-03-2) is used in various industries. It is a key intermediate ...

Compound Q&A

What precautions should be taken when handling Difluoro(phenyl)acetic acid (CAS: 360-03-2)?

When handling Difluoro(phenyl)acetic acid (CAS: 360-03-2), it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...