Compound Q&A

What industries use 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8)?

Answer

6-(Trifluoromethyl)nicotinic acid
6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8) is primarily used in the pharmaceutical industry for the synthesis of drug intermediates. It is also utilized in the polymer industry as an additive to enhance properties like heat resistance and stability. Additionally, it finds applications in sensor technology and as a precursor in the preparation of organic semiconductor materials.

About

English Name 6-(Trifluoromethyl)nicotinic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CC(=NC=C1C(=O)O)C(F)(F)F
InChIKey JNYLMODTPLSLIF-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8)?

6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8) is a white crystalline solid with a molecular w...

Compound Q&A

How is 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8) typically synthesized?

6-(Trifluoromethyl)nicotinic acid can be synthesized by the trifluoromethylation of nicotinic acid. ...

Compound Q&A

What precautions should be taken when handling 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8)?

When handling 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...